Compound Q&A

What is 2-Methyl-2-propanyl 1-(4-formylphenyl)-1-oxo-5,8,11,14-tetraoxa-2-azaheptadecan-17-oate (CAS: 1807518-64-4)?

Answer

2-Methyl-2-propanyl 1-(4-formylphenyl)-1-oxo-5,8,11,14-tetraoxa-2-azaheptadecan-17-oate
2-Methyl-2-propanyl 1-(4-formylphenyl)-1-oxo-5,8,11,14-tetraoxa-2-azaheptadecan-17-oate is a complex organic compound with the CAS number 1807518-64-4. It is a cyclic ester derivative with a unique molecular structure, characterized by its oxime and oxo functionalities connected to a heptadecane chain with specific substituents.

About

English Name 2-Methyl-2-propanyl 1-(4-formylphenyl)-1-oxo-5,8,11,14-tetraoxa-2-azaheptadecan-17-oate
Molecular Formula C23H35NO8
Molecular Weight 453.53 g/mol
SMILES O=Cc1ccc(cc1)C(=O)NCCOCCOCCOCCOCCC(=O)OC(C)(C)C
InChIKey LWNKMVXZTVDYHO-UHFFFAOYSA-N
Last Updated: 2026-01-09 06:33

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 1-(4-formylphenyl)-1-oxo-5,8,11,14-tetraoxa-2-azaheptadecan-17-oate (CAS: 1807518-64-4)?

This compound is primarily used in pharmaceutical research for its unique chemical properties. It is...

Compound Q&A

Is 2-Methyl-2-propanyl 1-(4-formylphenyl)-1-oxo-5,8,11,14-tetraoxa-2-azaheptadecan-17-oate (CAS: 1807518-64-4) safe?

While the safety of this compound is subject to proper handling, it is generally considered safe whe...

Compound Q&A

How should 2-Methyl-2-propanyl 1-(4-formylphenyl)-1-oxo-5,8,11,14-tetraoxa-2-azaheptadecan-17-oate (CAS: 1807518-64-4) be stored?

This compound should be stored in a cool, dry, and well-ventilated area away from direct sunlight an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...