Compound Q&A

What is Gal beta(1-3)[Neu5Ac alpha(2-6)]GalNAc-alpha-pNP (CAS: 1316822-90-8)?

Answer

Gal beta(1-3)[Neu5Ac alpha(2-6)]GalNAc-alpha-pNP
Gal beta(1-3)[Neu5Ac alpha(2-6)]GalNAc-alpha-pNP (CAS: 1316822-90-8) is a synthetic oligosaccharide derivative used in biotechnology and pharmaceutical research. It is composed of galactose (Gal), sialic acid (Neu5Ac), N-acetylgalactosamine (GalNAc), and benzenepropanoic acid (pNP).

About

English Name Gal beta(1-3)[Neu5Ac alpha(2-6)]GalNAc-alpha-pNP
Molecular Formula C31H45N3O21
Molecular Weight 795.7 g/mol
SMILES CC(=O)N[C@H]1[C@@H](Oc2ccc([N+](=O)[O-])cc2)O[C@H](CO[C@]2(C(=O)O)C[C@H](O)[C@@H](NC(C)=O)[C@H]([C@H](O)[C@H](O)CO)O2)[C@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O
InChIKey OQZSJFGKSKBLDR-SYEPIUQRSA-N
Last Updated: 2026-01-09 06:33

Related Q&A

Compound Q&A

What are the main uses of Gal beta(1-3)[Neu5Ac alpha(2-6)]GalNAc-alpha-pNP (CAS: 1316822-90-8)?

Gal beta(1-3)[Neu5Ac alpha(2-6)]GalNAc-alpha-pNP (CAS: 1316822-90-8) is primarily used in the develo...

Compound Q&A

Is Gal beta(1-3)[Neu5Ac alpha(2-6)]GalNAc-alpha-pNP (CAS: 1316822-90-8) safe?

Gal beta(1-3)[Neu5Ac alpha(2-6)]GalNAc-alpha-pNP (CAS: 1316822-90-8) is generally considered safe wh...

Compound Q&A

How should Gal beta(1-3)[Neu5Ac alpha(2-6)]GalNAc-alpha-pNP (CAS: 1316822-90-8) be stored?

Gal beta(1-3)[Neu5Ac alpha(2-6)]GalNAc-alpha-pNP (CAS: 1316822-90-8) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...