Compound Q&A

What are the physical and chemical properties of 2,4-Dimethylpentane - ruthenium (2:1) (CAS: 85908-78-7)?

Answer

2,4-Dimethylpentane - ruthenium (2:1)
2,4-Dimethylpentane - ruthenium (2:1) (CAS: 85908-78-7) is a complex organic compound with a molecular weight of approximately 182.17 g/mol. It exists in a crystalline form. The compound is poorly soluble in water but soluble in organic solvents such as hexane and toluene. Its reactivity is moderate and it typically requires catalytic conditions for chemical reactions. It is often used as a catalyst in various organic transformations.

About

CAS No 85908-78-7
English Name 2,4-Dimethylpentane - ruthenium (2:1)
Molecular Formula C14H32Ru
Molecular Weight 301.48 g/mol
SMILES CC(C)CC(C)C.CC(C)CC(C)C.[Ru]
InChIKey BXIVSAONENJIDX-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

How is 2,4-Dimethylpentane - ruthenium (2:1) (CAS: 85908-78-7) typically synthesized?

2,4-Dimethylpentane - ruthenium (2:1) (CAS: 85908-78-7) is typically synthesized via a coordination ...

Compound Q&A

What industries use 2,4-Dimethylpentane - ruthenium (2:1) (CAS: 85908-78-7)?

2,4-Dimethylpentane - ruthenium (2:1) (CAS: 85908-78-7) finds applications in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 2,4-Dimethylpentane - ruthenium (2:1) (CAS: 85908-78-7)?

When handling 2,4-Dimethylpentane - ruthenium (2:1) (CAS: 85908-78-7), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...