Compound Q&A

What are the physical and chemical properties of TIMB (CAS: 475094-90-7)?

Answer

TIMB
TIMB (CAS: 475094-90-7) is a white crystalline powder with a molecular weight of approximately 292.04 g/mol. It is slightly soluble in water and ethanol. TIMB is relatively stable under normal conditions but can react with strong acids to form the corresponding salts. It has good thermal stability and is typically used in various applications requiring its unique properties.

About

English Name TIMB
Molecular Formula C22H22N8
Molecular Weight 398.47 g/mol
SMILES C1(CN2C=CN=C2)=CC(CN3C=CN=C3)=C(C=C1CN4C=CN=C4)CN5C=CN=C5
InChIKey YSFJZLVJLAOPGF-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

How is TIMB (CAS: 475094-90-7) typically synthesized?

TIMB (CAS: 475094-90-7) is synthesized through a multi-step process involving the condensation of a ...

Compound Q&A

What industries use TIMB (CAS: 475094-90-7)?

TIMB (CAS: 475094-90-7) is used in a variety of industries. It is particularly popular in the pharma...

Compound Q&A

What precautions should be taken when handling TIMB (CAS: 475094-90-7)?

When handling TIMB (CAS: 475094-90-7), it is essential to wear appropriate Personal Protective Equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...