Compound Q&A

What industries use Methyl 2-(chloromethyl)-3-nitrobenzoate (CAS: 1218910-61-2)?

Answer

Methyl 2-(chloromethyl)-3-nitrobenzoate
Methyl 2-(chloromethyl)-3-nitrobenzoate is used in the pharmaceutical industry for the synthesis of certain intermediates and in the polymer industry for the production of plasticizers. It also finds applications in the field of sensors and electronics due to its unique chemical properties.

About

English Name Methyl 2-(chloromethyl)-3-nitrobenzoate
Molecular Formula C9H8ClNO4
Molecular Weight 229.6171 g/mol
SMILES COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])CCl
InChIKey OGMCDJBYZAKJTP-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-(chloromethyl)-3-nitrobenzoate (CAS: 1218910-61-2)?

Methyl 2-(chloromethyl)-3-nitrobenzoate is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is Methyl 2-(chloromethyl)-3-nitrobenzoate (CAS: 1218910-61-2) typically synthesized?

Methyl 2-(chloromethyl)-3-nitrobenzoate is typically synthesized by the coupling of methyl 2-(chloro...

Compound Q&A

What precautions should be taken when handling Methyl 2-(chloromethyl)-3-nitrobenzoate (CAS: 1218910-61-2)?

When handling Methyl 2-(chloromethyl)-3-nitrobenzoate, it is crucial to use appropriate personal pro...

Compound Q&A

What precautions should be taken when handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2)?

When handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2), it is importan...

16712-20-2Lithium chloride hyd...
Compound Q&A

Is 4-(4H-1,2,4-Triazol-4-yl)piperidine (CAS: 690261-92-8) safe?

4-(4H-1,2,4-Triazol-4-yl)piperidine is generally considered safe for use in phar...

690261-92-84-(4H-1,2,4-Triazol-...
Compound Q&A

How should waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) be handled?

Waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) should be collecte...

16733-85-01,3-Thiazole-2-carbo...
Compound Q&A

What regulatory guidelines apply to 5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3)?

5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3) is subject to regulat...

934175-58-35-(Difluoromethyl)-2...