Compound Q&A

What industries use 4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3)?

Answer

4-Nitronicotinic acid 1-oxide
4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3) is primarily used in the pharmaceutical industry for the synthesis of drugs, particularly those involving derivatives of nicotinic acid. It also finds applications in polymer industry for modifying polymer properties and in the production of sensors and semiconductors for specific electronic applications.

About

CAS No 1078-05-3
English Name 4-Nitronicotinic acid 1-oxide
Molecular Formula C6H4N2O5
Molecular Weight 184.11 g/mol
SMILES C1=C[N+](=CC(=C1[N+](=O)[O-])C(=O)O)[O-]
InChIKey OYLXIYDCLHUDQV-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3)?

4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3) typically synthesized?

4-Nitronicotinic acid 1-oxide can be synthesized through the nitration of nicotinic acid followed by...

Compound Q&A

What precautions should be taken when handling 4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3)?

When handling 4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3), it is crucial to wear appropriate pers...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...