Compound Q&A

How is 4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3) typically synthesized?

Answer

4-Nitronicotinic acid 1-oxide
4-Nitronicotinic acid 1-oxide can be synthesized through the nitration of nicotinic acid followed by the formation of the oxime derivative. The nitration step typically requires concentrated nitric acid and sulfuric acid as a catalyst. The oxime formation is achieved by reacting the nitro compound with hydroxylamine under basic conditions.

About

CAS No 1078-05-3
English Name 4-Nitronicotinic acid 1-oxide
Molecular Formula C6H4N2O5
Molecular Weight 184.11 g/mol
SMILES C1=C[N+](=CC(=C1[N+](=O)[O-])C(=O)O)[O-]
InChIKey OYLXIYDCLHUDQV-UHFFFAOYSA-N
Last Updated: 2026-01-08 21:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3)?

4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3)?

4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3) is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3)?

When handling 4-Nitronicotinic acid 1-oxide (CAS: 1078-05-3), it is crucial to wear appropriate pers...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...