Compound Q&A

What precautions should be taken when handling 5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one (CAS: 5084-19-5)?

Answer

5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one
When handling 5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one (CAS: 5084-19-5), it is essential to follow standard laboratory safety protocols. Wear protective equipment such as gloves, safety glasses, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Store it in a cool, dry place away from heat sources. In case of a spill, use appropriate spill cleanup materials and consult the Safety Data Sheet (SDS) for specific instructions. This compound is not inherently toxic, but proper handling is crucial to prevent accidental exposure or contamination.

About

CAS No 5084-19-5
English Name 5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one
Molecular Formula C20H20O8
Molecular Weight 388.37 g/mol
SMILES COC1=CC2=C(C(O)=C1)C(=O)C(OC)=C(O2)C1=CC(OC)=C(OC)C(OC)=C1
InChIKey SUNUQCQIFHHEOW-UHFFFAOYSA-N
Last Updated: 2026-01-07 14:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one (CAS: 5084-19-5)?

5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one (CAS: 5084-19-5) is a yellow cry...

Compound Q&A

How is 5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one (CAS: 5084-19-5) typically synthesized?

5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one (CAS: 5084-19-5) can be synthesi...

Compound Q&A

What industries use 5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one (CAS: 5084-19-5)?

5-Hydroxy-3,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one (CAS: 5084-19-5) finds applicati...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...