Compound Q&A

What are the physical and chemical properties of N'-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylimidoformamide (CAS: 1269400-04-5)?

Answer

N'-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylimidoformamide
N'-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylimidoformamide is a crystalline compound with a molecular weight of approximately 332.12 g/mol. It has a low solubility in water but is soluble in common organic solvents like dichloromethane and acetonitrile. This compound is known for its high reactivity, particularly in nucleophilic substitution reactions and is often used in the synthesis of other organic compounds.

About

English Name N'-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylimidoformamide
Molecular Formula C11H12N4O3
Molecular Weight 17.03 g/mol
SMILES N#Cc1cc([N+](=O)[O-])c(cc1N=CN(C)C)OC
InChIKey KRQJJPTWQAWICH-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:18

Related Q&A

Compound Q&A

How is N'-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylimidoformamide (CAS: 1269400-04-5) typically synthesized?

N'-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylimidoformamide can be synthesized through the react...

Compound Q&A

What industries use N'-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylimidoformamide (CAS: 1269400-04-5)?

N'-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylimidoformamide is used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling N'-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylimidoformamide (CAS: 1269400-04-5)?

Handling N'-(2-Cyano-5-methoxy-4-nitrophenyl)-N,N-dimethylimidoformamide requires wearing personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...