Compound Q&A

What industries use 3-[2-(Hydroxymethyl)-1H-benzimidazol-1-yl]propanoic acid (CAS: 797806-58-7)?

Answer

3-[2-(Hydroxymethyl)-1H-benzimidazol-1-yl]propanoic acid
3-[2-(Hydroxymethyl)-1H-benzimidazol-1-yl]propanoic acid is used in the pharmaceutical industry for the development of certain drugs, as well as in the sensor and semiconductor industries for its unique chemical properties. It is also utilized in the polymer industry for specific applications requiring its functionality.

About

English Name 3-[2-(Hydroxymethyl)-1H-benzimidazol-1-yl]propanoic acid
Molecular Formula C11H12N2O3
Molecular Weight 220.23 g/mol
SMILES O=C(O)CCN1C(CO)=NC2=CC=CC=C12
InChIKey PFJKYWHOQRJTOU-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[2-(Hydroxymethyl)-1H-benzimidazol-1-yl]propanoic acid (CAS: 797806-58-7)?

3-[2-(Hydroxymethyl)-1H-benzimidazol-1-yl]propanoic acid is a white crystalline solid with a molecul...

Compound Q&A

How is 3-[2-(Hydroxymethyl)-1H-benzimidazol-1-yl]propanoic acid (CAS: 797806-58-7) typically synthesized?

3-[2-(Hydroxymethyl)-1H-benzimidazol-1-yl]propanoic acid can be synthesized via a multi-step process...

Compound Q&A

What precautions should be taken when handling 3-[2-(Hydroxymethyl)-1H-benzimidazol-1-yl]propanoic acid (CAS: 797806-58-7)?

When handling 3-[2-(Hydroxymethyl)-1H-benzimidazol-1-yl]propanoic acid, it is recommended to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...