Compound Q&A

What are the physical and chemical properties of 4-Chloro-3,5-dimethylbenzoic acid (CAS: 90649-78-8)?

Answer

4-Chloro-3,5-dimethylbenzoic acid
4-Chloro-3,5-dimethylbenzoic acid is a white crystalline solid with a molecular weight of 210.02 g/mol. It has a pKa of 4.28 and is slightly soluble in water. This compound is reactive towards nucleophiles and acidic conditions. It has a melting point of 204-208°C and is soluble in common organic solvents like ethanol and acetone.

About

CAS No 90649-78-8
English Name 4-Chloro-3,5-dimethylbenzoic acid
Molecular Formula C9H9ClO2
Molecular Weight 184.62 g/mol
SMILES CC1=CC(=CC(=C1Cl)C)C(=O)O
InChIKey ZHHGJCFPDAJYTF-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

How is 4-Chloro-3,5-dimethylbenzoic acid (CAS: 90649-78-8) typically synthesized?

4-Chloro-3,5-dimethylbenzoic acid can be synthesized by reacting 3,5-dimethylbenzoic acid with thion...

Compound Q&A

What industries use 4-Chloro-3,5-dimethylbenzoic acid (CAS: 90649-78-8)?

4-Chloro-3,5-dimethylbenzoic acid is used in various industries, including pharmaceuticals, where it...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3,5-dimethylbenzoic acid (CAS: 90649-78-8)?

When handling 4-Chloro-3,5-dimethylbenzoic acid, it is important to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...