Compound Q&A

How is 2-Methyl-2-propanyl (35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl)carbamate (CAS: 890091-42-6) typically synthesized?

Answer

2-Methyl-2-propanyl (35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl)carbamate
This compound can be synthesized through multistep reactions involving the coupling of amino groups with oxapentatriacontane derivatives. Commonly, it involves the use of carbodiimide as a coupling agent, followed by protective group manipulations and deprotection steps to achieve the desired product. The overall yield is moderate to good depending on the purity of reactants and the efficiency of coupling reactions.

About

English Name 2-Methyl-2-propanyl (35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl)carbamate
Molecular Formula C29H60N2O13
Molecular Weight 644.8 g/mol
SMILES CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN
InChIKey GISRSYIQHFGCMC-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl)carbamate (CAS: 890091-42-6)?

This compound is a solid with a crystalline form. It has a high molecular weight due to its complex ...

Compound Q&A

What industries use 2-Methyl-2-propanyl (35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl)carbamate (CAS: 890091-42-6)?

This compound is primarily used in the pharmaceutical industry for the development of novel drug can...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl (35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl)carbamate (CAS: 890091-42-6)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...