Compound Q&A

What industries use 5-Methoxy-2-(trifluoromethyl)benzaldehyde (CAS: 944905-42-4)?

Answer

5-Methoxy-2-(trifluoromethyl)benzaldehyde
5-Methoxy-2-(trifluoromethyl)benzaldehyde (CAS: 944905-42-4) is used primarily in the pharmaceutical and fine chemical industries. It serves as a precursor in the synthesis of various compounds with medicinal properties. Additionally, it is utilized in the production of organic materials and sensors due to its unique chemical properties.

About

English Name 5-Methoxy-2-(trifluoromethyl)benzaldehyde
Molecular Formula C9H7F3O2
Molecular Weight 204.14699999999993 g/mol
SMILES COc1ccc(c(c1)C=O)C(F)(F)F
InChIKey QFKMLBPPJRRDBX-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methoxy-2-(trifluoromethyl)benzaldehyde (CAS: 944905-42-4)?

5-Methoxy-2-(trifluoromethyl)benzaldehyde (CAS: 944905-42-4) is a white or off-white crystalline sol...

Compound Q&A

How is 5-Methoxy-2-(trifluoromethyl)benzaldehyde (CAS: 944905-42-4) typically synthesized?

5-Methoxy-2-(trifluoromethyl)benzaldehyde (CAS: 944905-42-4) is typically synthesized via the method...

Compound Q&A

What precautions should be taken when handling 5-Methoxy-2-(trifluoromethyl)benzaldehyde (CAS: 944905-42-4)?

When handling 5-Methoxy-2-(trifluoromethyl)benzaldehyde (CAS: 944905-42-4), use protective equipment...

Compound Q&A

What is the market or research trend for N-(4-Methoxybenzyl)-2-pyridinamine (CAS: 52818-63-0)?

N-(4-Methoxybenzyl)-2-pyridinamine (CAS: 52818-63-0) is increasingly being used ...

52818-63-0N-(4-Methoxybenzyl)-...
Compound Q&A

What precautions should be taken when handling Ethyl 4-(2-chlorophenyl)-1,3-thiazole-2-carboxylate (CAS: 1050507-06-6)?

When handling Ethyl 4-(2-chlorophenyl)-1,3-thiazole-2-carboxylate, appropriate p...

1050507-06-6Ethyl 4-(2-chlorophe...
Compound Q&A

What regulatory guidelines apply to diethyldiselane (CAS: 628-39-7)?

Diethyldiselane (CAS: 628-39-7) is classified under the Globally Harmonized Syst...

628-39-7Diethyldiselane
Compound Q&A

What is the market or research trend for oxocopper (CAS: 12053-18-8)?

The market for oxocopper (CAS: 12053-18-8) is primarily driven by its use in cat...

12053-18-8oxocopper; oxo-(oxoc...