Compound Q&A

How is Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9) typically synthesized?

Answer

Dibenzyl carbonimidoylbiscarbamate
Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9) is typically synthesized through a multistep process involving the reaction of benzyloxycarbonyl azide with dibenzyl dicarboxylate, followed by decarboxylation and condensation. The reaction is catalyzed by a transition metal such as iron(III) chloride and yields the compound with high selectivity and good yield.

About

CAS No 10065-79-9
English Name Dibenzyl carbonimidoylbiscarbamate
Molecular Formula C17H17N3O4
Molecular Weight 327.34000000000003 g/mol
SMILES N=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1
InChIKey WUPOXNUSSFCSGV-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9)?

Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9) is a crystalline solid with a molecular weight ...

Compound Q&A

What industries use Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9)?

Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9) finds applications in various industries, parti...

Compound Q&A

What precautions should be taken when handling Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9)?

When handling Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9), it is essential to wear appropri...

Compound Q&A

Is 2-(2-chloroacetamido)-3-phenylpropanoic acid (CAS: 7765-11-9) safe?

2-(2-Chloroacetamido)-3-phenylpropanoic acid (CAS: 7765-11-9) is generally consi...

7765-11-92-(2-chloroacetamido...
Compound Q&A

Is 2-(Benzyloxy)-5-bromobenzoic acid (CAS: 62176-31-2) safe?

2-(Benzyloxy)-5-bromobenzoic acid can be handled safely if appropriate precautio...

62176-31-22-(Benzyloxy)-5-brom...
Compound Q&A

What is (4-Methyl-1,2,5-oxadiazol-3-yl)methanamine hydrochloride (CAS: 1159825-48-5)?

(4-Methyl-1,2,5-oxadiazol-3-yl)methanamine hydrochloride is a chemical compound ...

1159825-48-5(4-Methyl-1,2,5-oxad...
Compound Q&A

What is 2-(5-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 917985-54-7)?

2-(5-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 917985-54...

917985-54-72-(5-Hexylthiophen-2...