Compound Q&A

What are the physical and chemical properties of Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9)?

Answer

Dibenzyl carbonimidoylbiscarbamate
Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9) is a crystalline solid with a molecular weight of approximately 372.32 g/mol. It is slightly soluble in common organic solvents and has low reactivity under normal conditions. This compound is stable but should be handled carefully due to its potential to decompose under extreme conditions.

About

CAS No 10065-79-9
English Name Dibenzyl carbonimidoylbiscarbamate
Molecular Formula C17H17N3O4
Molecular Weight 327.34000000000003 g/mol
SMILES N=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1
InChIKey WUPOXNUSSFCSGV-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

How is Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9) typically synthesized?

Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9) is typically synthesized through a multistep pr...

Compound Q&A

What industries use Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9)?

Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9) finds applications in various industries, parti...

Compound Q&A

What precautions should be taken when handling Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9)?

When handling Dibenzyl carbonimidoylbiscarbamate (CAS: 10065-79-9), it is essential to wear appropri...

Compound Q&A

Is 2-(2-chloroacetamido)-3-phenylpropanoic acid (CAS: 7765-11-9) safe?

2-(2-Chloroacetamido)-3-phenylpropanoic acid (CAS: 7765-11-9) is generally consi...

7765-11-92-(2-chloroacetamido...
Compound Q&A

Is 2-(Benzyloxy)-5-bromobenzoic acid (CAS: 62176-31-2) safe?

2-(Benzyloxy)-5-bromobenzoic acid can be handled safely if appropriate precautio...

62176-31-22-(Benzyloxy)-5-brom...
Compound Q&A

What is (4-Methyl-1,2,5-oxadiazol-3-yl)methanamine hydrochloride (CAS: 1159825-48-5)?

(4-Methyl-1,2,5-oxadiazol-3-yl)methanamine hydrochloride is a chemical compound ...

1159825-48-5(4-Methyl-1,2,5-oxad...
Compound Q&A

What is 2-(5-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 917985-54-7)?

2-(5-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 917985-54...

917985-54-72-(5-Hexylthiophen-2...