Compound Q&A

How is 4'-(Tribromomethyl)-[1,1'-biphenyl]-2-carbonitrile (CAS: 876063-64-8) typically synthesized?

Answer

4'-(Tribromomethyl)-[1,1'-biphenyl]-2-carbonitrile
4'-(Tribromomethyl)-[1,1'-biphenyl]-2-carbonitrile can be synthesized via a multistep process involving bromination of [1,1'-biphenyl]-2-carbonitrile followed by coupling reactions. The synthesis typically requires the use of appropriate catalysts and reagents, with high selectivity and yield achievable under optimized conditions.

About

English Name 4'-(Tribromomethyl)-[1,1'-biphenyl]-2-carbonitrile
Molecular Formula C14H8Br3N
Molecular Weight 429.93 g/mol
SMILES C1=CC=C(C(=C1)C#N)C2=CC=C(C=C2)C(Br)(Br)Br
InChIKey ZMOBZMJHPMWMLQ-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:52

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-(Tribromomethyl)-[1,1'-biphenyl]-2-carbonitrile (CAS: 876063-64-8)?

4'-(Tribromomethyl)-[1,1'-biphenyl]-2-carbonitrile is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 4'-(Tribromomethyl)-[1,1'-biphenyl]-2-carbonitrile (CAS: 876063-64-8)?

4'-(Tribromomethyl)-[1,1'-biphenyl]-2-carbonitrile is used in the pharmaceutical and sensor industri...

Compound Q&A

What precautions should be taken when handling 4'-(Tribromomethyl)-[1,1'-biphenyl]-2-carbonitrile (CAS: 876063-64-8)?

When handling 4'-(Tribromomethyl)-[1,1'-biphenyl]-2-carbonitrile, it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...