Compound Q&A

What is 4-Chloro-2,3-pyridinedicarboxylic acid (CAS: 605661-85-6)?

Answer

4-Chloro-2,3-pyridinedicarboxylic acid
4-Chloro-2,3-pyridinedicarboxylic acid is an organic compound with the CAS number 605661-85-6. It is a white or light yellow solid with a molecular formula of C6H3ClN2O4. This compound is characterized by its acidic properties and is used in various applications such as pharmaceuticals and research.

About

English Name 4-Chloro-2,3-pyridinedicarboxylic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CN=C(C(=C1Cl)C(=O)O)C(=O)O
InChIKey ASZRIBNKXOGEDF-UHFFFAOYSA-N
Last Updated: 2026-01-07 01:42

Related Q&A

Compound Q&A

What are the main uses of 4-Chloro-2,3-pyridinedicarboxylic acid (CAS: 605661-85-6)?

4-Chloro-2,3-pyridinedicarboxylic acid is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

Is 4-Chloro-2,3-pyridinedicarboxylic acid (CAS: 605661-85-6) safe?

4-Chloro-2,3-pyridinedicarboxylic acid (CAS: 605661-85-6) is generally safe when handled with approp...

Compound Q&A

How should 4-Chloro-2,3-pyridinedicarboxylic acid (CAS: 605661-85-6) be stored?

4-Chloro-2,3-pyridinedicarboxylic acid (CAS: 605661-85-6) should be stored in a cool, dry place to a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...