Compound Q&A

What is Fmoc-1-piperidine-3-acetic acid (CAS: 885951-96-2)?

Answer

Fmoc-1-piperidine-3-acetic acid
Fmoc-1-piperidine-3-acetic acid, also known as Fmoc-3-PA, is a chemical compound with the CAS number 885951-96-2. It is an ester derivative of piperidine-3-carboxylic acid and is widely used in solid-phase peptide synthesis due to its excellent leaving group properties.

About

English Name Fmoc-1-piperidine-3-acetic acid
Molecular Formula C22H23NO4
Molecular Weight 365.43 g/mol
SMILES C1CC(CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CC(=O)O
InChIKey ZIOKJVDGYGHREC-UHFFFAOYSA-N
Last Updated: 2026-01-06 17:16

Related Q&A

Compound Q&A

What are the main uses of Fmoc-1-piperidine-3-acetic acid (CAS: 885951-96-2)?

Fmoc-1-piperidine-3-acetic acid is primarily used in the field of organic synthesis, particularly in...

Compound Q&A

Is Fmoc-1-piperidine-3-acetic acid (CAS: 885951-96-2) safe?

Fmoc-1-piperidine-3-acetic acid is considered safe when handled with appropriate safety measures. It...

Compound Q&A

How should Fmoc-1-piperidine-3-acetic acid (CAS: 885951-96-2) be stored?

Fmoc-1-piperidine-3-acetic acid should be stored in a cool, dry place, away from direct sunlight and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...