Compound Q&A

What are the main uses of 1-Bromo-4-fluoro-2-nitro-5-(trifluoromethyl)benzene (CAS: 889459-13-6)?

Answer

1-Bromo-4-fluoro-2-nitro-5-(trifluoromethyl)benzene
1-Bromo-4-fluoro-2-nitro-5-(trifluoromethyl)benzene is primarily used in pharmaceuticals and chemical research for the synthesis of other compounds. It serves as a key intermediate in the development of novel drugs and materials. Its unique substituents make it valuable in designing molecules with specific properties.

About

English Name 1-Bromo-4-fluoro-2-nitro-5-(trifluoromethyl)benzene
Molecular Formula C7H2BrF4NO2
Molecular Weight 287.99 g/mol
SMILES C1=C(C(=CC(=C1Br)[N+](=O)[O-])F)C(F)(F)F
InChIKey LUJHTOFZEPHSLH-UHFFFAOYSA-N
Last Updated: 2026-01-06 13:08

Related Q&A

Compound Q&A

What is 1-Bromo-4-fluoro-2-nitro-5-(trifluoromethyl)benzene (CAS: 889459-13-6)?

1-Bromo-4-fluoro-2-nitro-5-(trifluoromethyl)benzene is a complex aromatic compound with the CAS numb...

Compound Q&A

Is 1-Bromo-4-fluoro-2-nitro-5-(trifluoromethyl)benzene (CAS: 889459-13-6) safe?

1-Bromo-4-fluoro-2-nitro-5-(trifluoromethyl)benzene can be hazardous due to its reactive nature and ...

Compound Q&A

How should 1-Bromo-4-fluoro-2-nitro-5-(trifluoromethyl)benzene (CAS: 889459-13-6) be stored?

1-Bromo-4-fluoro-2-nitro-5-(trifluoromethyl)benzene should be stored in a cool, dry place away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...