Compound Q&A

How should 5'-Thymidylic acid (CAS: 365-07-1) be stored?

Answer

5'-Thymidylic acid
5'-Thymidylic acid (CAS: 365-07-1) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent degradation. Proper storage conditions are essential to maintain its stability and efficacy.

About

CAS No 365-07-1
English Name 5'-Thymidylic acid
Molecular Formula C10H15N2O8P
Molecular Weight 322.21 g/mol
SMILES CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)O)O
InChIKey GYOZYWVXFNDGLU-XLPZGREQSA-N
Last Updated: 2026-01-06 13:08

Related Q&A

Compound Q&A

What is 5'-Thymidylic acid (CAS: 365-07-1)?

5'-Thymidylic acid (CAS: 365-07-1) is a nucleoside derivative with the chemical formula C9H12N2O7P. ...

Compound Q&A

What are the main uses of 5'-Thymidylic acid (CAS: 365-07-1)?

5'-Thymidylic acid (CAS: 365-07-1) is primarily used in the production of nucleoside analogs, as a b...

Compound Q&A

Is 5'-Thymidylic acid (CAS: 365-07-1) safe?

5'-Thymidylic acid (CAS: 365-07-1) is generally considered safe when handled with appropriate protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...