Compound Q&A

What is 4',4'',4''',4''''-Methanetetrayltetra(4-biphenylcarboxylic acid) (CAS: 1208241-38-6)?

Answer

4',4'',4''',4''''-Methanetetrayltetra(4-biphenylcarboxylic acid)
4',4'',4''',4''''-Methanetetrayltetra(4-biphenylcarboxylic acid) is a complex organic compound with a molecular structure featuring a core of four biphenyl groups connected by methylene bridges. It is known for its high stability and unique electronic properties.

About

English Name 4',4'',4''',4''''-Methanetetrayltetra(4-biphenylcarboxylic acid)
Molecular Formula C53H36O8
Molecular Weight 800.86 g/mol
SMILES OC(=O)C1C=CC(=CC=1)C1C=CC(=CC=1)C(C1C=CC(=CC=1)C1C=CC(=CC=1)C(O)=O)(C1C=CC(=CC=1)C1C=CC(=CC=1)C(O)=O)C1C=CC(=CC=1)C1C=CC(=CC=1)C(O)=O
InChIKey ONMZLXHMUBUCKZ-UHFFFAOYSA-N
Last Updated: 2026-01-06 13:08

Related Q&A

Compound Q&A

What are the main uses of 4',4'',4''',4''''-Methanetetrayltetra(4-biphenylcarboxylic acid) (CAS: 1208241-38-6)?

This compound is primarily used in the development of organic electronic devices, such as organic li...

Compound Q&A

Is 4',4'',4''',4''''-Methanetetrayltetra(4-biphenylcarboxylic acid) (CAS: 1208241-38-6) safe?

While 4',4'',4''',4''''-Methanetetrayltetra(4-biphenylcarboxylic acid) is generally safe, proper han...

Compound Q&A

How should 4',4'',4''',4''''-Methanetetrayltetra(4-biphenylcarboxylic acid) (CAS: 1208241-38-6) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...