Compound Q&A

What is 2-(Piperidin-1-ylmethyl)benzoic acid (CAS: 917747-57-0)?

Answer

2-(Piperidin-1-ylmethyl)benzoic acid
2-(Piperidin-1-ylmethyl)benzoic acid is an organic compound with the CAS number 917747-57-0. It is a derivative of benzoic acid with a piperidin-1-ylmethyl group attached to the aromatic ring. This compound is used in pharmaceuticals and research due to its unique structural properties.

About

English Name 2-(Piperidin-1-ylmethyl)benzoic acid
Molecular Formula C13H17NO2
Molecular Weight 219.28 g/mol
SMILES C1CCN(CC1)CC2=CC=CC=C2C(=O)O
InChIKey SETGNIQLYMGVGH-UHFFFAOYSA-N
Last Updated: 2026-01-06 09:11

Related Q&A

Compound Q&A

What are the main uses of 2-(Piperidin-1-ylmethyl)benzoic acid (CAS: 917747-57-0)?

2-(Piperidin-1-ylmethyl)benzoic acid is primarily used in the pharmaceutical industry for the synthe...

Compound Q&A

Is 2-(Piperidin-1-ylmethyl)benzoic acid (CAS: 917747-57-0) safe?

2-(Piperidin-1-ylmethyl)benzoic acid is considered safe for laboratory use when handled with appropr...

Compound Q&A

How should 2-(Piperidin-1-ylmethyl)benzoic acid (CAS: 917747-57-0) be stored?

2-(Piperidin-1-ylmethyl)benzoic acid should be stored in a tightly closed container in a cool, dry p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...