Compound Q&A

What is 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetraphenol (CAS: 835878-20-1)?

Answer

4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetraphenol
4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetraphenol is a complex organic compound characterized by its tetraphenolic structure connected by pyrene. It exhibits unique optical and electronic properties due to its conjugated system, making it useful in various applications.

About

English Name 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetraphenol
Molecular Formula C40H26O4
Molecular Weight 570.64 g/mol
SMILES C1=CC(=CC=C1C2=CC(=C3C=CC4=C(C=C(C5=C4C3=C2C=C5)C6=CC=C(C=C6)O)C7=CC=C(C=C7)O)C8=CC=C(C=C8)O)O
InChIKey QUTBOLCVZGYEJF-UHFFFAOYSA-N
Last Updated: 2026-01-06 09:11

Related Q&A

Compound Q&A

What are the main uses of 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetraphenol (CAS: 835878-20-1)?

This compound is primarily used in photoluminescent materials, solar cell applications, and as a dye...

Compound Q&A

Is 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetraphenol (CAS: 835878-20-1) safe?

While generally stable, handling of 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetraphenol requires cauti...

Compound Q&A

How should 4,4',4'',4'''-(Pyrene-1,3,6,8-tetrayl)tetraphenol (CAS: 835878-20-1) be stored?

Store in a cool, dry place away from direct sunlight and heat sources. Use airtight containers to pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...