Compound Q&A

What is Ethyl hydrogen (3,4-dichlorophenyl)carbonimidate (CAS: 7159-94-6)?

Answer

Ethyl hydrogen (3,4-dichlorophenyl)carbonimidate
Ethyl hydrogen (3,4-dichlorophenyl)carbonimidate (CAS: 7159-94-6) is a chemical compound characterized by its molecular structure and properties, serving as a key intermediate in the synthesis of various pharmaceuticals and organic compounds. It is a colorless or light yellow liquid at room temperature with a molecular formula of C9H7Cl2N2O.

About

CAS No 7159-94-6
English Name Ethyl hydrogen (3,4-dichlorophenyl)carbonimidate
Molecular Formula C9H9Cl2NO2
Molecular Weight 234.08 g/mol
SMILES CCOC(=O)NC1=CC(=C(C=C1)Cl)Cl
InChIKey AOVLXBXJFYNQAZ-UHFFFAOYSA-N
Last Updated: 2026-01-06 06:07

Related Q&A

Compound Q&A

What are the main uses of Ethyl hydrogen (3,4-dichlorophenyl)carbonimidate (CAS: 7159-94-6)?

Ethyl hydrogen (3,4-dichlorophenyl)carbonimidate (CAS: 7159-94-6) is primarily used as an intermedia...

Compound Q&A

Is Ethyl hydrogen (3,4-dichlorophenyl)carbonimidate (CAS: 7159-94-6) safe?

Ethyl hydrogen (3,4-dichlorophenyl)carbonimidate (CAS: 7159-94-6) is safe if handled with appropriat...

Compound Q&A

How should Ethyl hydrogen (3,4-dichlorophenyl)carbonimidate (CAS: 7159-94-6) be stored?

Ethyl hydrogen (3,4-dichlorophenyl)carbonimidate (CAS: 7159-94-6) should be stored in a cool, dry pl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...