Compound Q&A

What precautions should be taken when handling Deoxybicalutamide (CAS: 906008-94-4)?

Answer

Deoxybicalutamide
When handling Deoxybicalutamide (CAS: 906008-94-4), it is essential to wear appropriate personal protective equipment (PPE), including gloves and a lab coat. Ensure that you use a fume hood for any operations that may release vapors. In case of a spill, neutralize it with an appropriate agent and follow the safety data sheet (SDS) for proper disposal. Handling should be done in a well-ventilated area to minimize exposure risk.

About

English Name Deoxybicalutamide
Molecular Formula C18H14F4N2O3S
Molecular Weight 403.4 g/mol
SMILES CC(CS(=O)(=O)C1=CC=C(C=C1)F)C(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F
InChIKey CLQOAZDMLVMGKV-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Deoxybicalutamide (CAS: 906008-94-4)?

Deoxybicalutamide (CAS: 906008-94-4) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

How is Deoxybicalutamide (CAS: 906008-94-4) typically synthesized?

Deoxybicalutamide (CAS: 906008-94-4) is synthesized through a multi-step process involving the modif...

Compound Q&A

What industries use Deoxybicalutamide (CAS: 906008-94-4)?

Deoxybicalutamide (CAS: 906008-94-4) is primarily used in the pharmaceutical industry, particularly ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...