Compound Q&A

What industries use Methyl 1-(triphenylmethyl)-2-aziridinecarboxylate (CAS: 76357-18-1)?

Answer

Methyl 1-(triphenylmethyl)-2-aziridinecarboxylate
Methyl 1-(triphenylmethyl)-2-aziridinecarboxylate (CAS: 76357-18-1) is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of drug molecules, and in the polymer industry, where it can be used as a functional monomer for making advanced materials. Additionally, it is utilized in sensor technology and semiconductor manufacturing for its unique chemical reactivity.

About

CAS No 76357-18-1
English Name Methyl 1-(triphenylmethyl)-2-aziridinecarboxylate
Molecular Formula C23H21NO2
Molecular Weight 343.4260000000001 g/mol
SMILES COC(=O)C1CN1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
InChIKey QGSITPKXYQEFIR-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1-(triphenylmethyl)-2-aziridinecarboxylate (CAS: 76357-18-1)?

Methyl 1-(triphenylmethyl)-2-aziridinecarboxylate (CAS: 76357-18-1) is a crystalline compound with a...

Compound Q&A

How is Methyl 1-(triphenylmethyl)-2-aziridinecarboxylate (CAS: 76357-18-1) typically synthesized?

Methyl 1-(triphenylmethyl)-2-aziridinecarboxylate (CAS: 76357-18-1) is typically synthesized by the ...

Compound Q&A

What precautions should be taken when handling Methyl 1-(triphenylmethyl)-2-aziridinecarboxylate (CAS: 76357-18-1)?

When handling Methyl 1-(triphenylmethyl)-2-aziridinecarboxylate (CAS: 76357-18-1), it is essential t...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...