Compound Q&A

What industries use 5-Fluorotryptophan (CAS: 97749-24-1)?

Answer

5-Fluorotryptophan
5-Fluorotryptophan is primarily used in pharmaceutical research, particularly in the development of new drugs. It is also used in academic research for studying protein synthesis and modifications. Its use in polymer and semiconductor industries is less common but possible for specific applications.

About

CAS No 97749-24-1
English Name 5-Fluorotryptophan
Molecular Formula C11H11FN2O2
Molecular Weight 222.22 g/mol
SMILES N[C@@H](C(=O)O)Cc1c[nH]c2c1cc(F)cc2
InChIKey INPQIVHQSQUEAJ-SECBINFHSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Fluorotryptophan (CAS: 97749-24-1)?

5-Fluorotryptophan is a colorless to white crystalline solid with a molecular weight of 209.06 g/mol...

Compound Q&A

How is 5-Fluorotryptophan (CAS: 97749-24-1) typically synthesized?

5-Fluorotryptophan is synthesized by fluorination of 5-hydroxyindole-3-acetic acid or tryptophan usi...

Compound Q&A

What precautions should be taken when handling 5-Fluorotryptophan (CAS: 97749-24-1)?

When handling 5-Fluorotryptophan, it is essential to wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...