Compound Q&A

What industries use 4-methyl-7-nitro-1H-indole-3-carbonitrile (CAS: 289483-82-5)?

Answer

4-methyl-7-nitro-1H-indole-3-carbonitrile
4-Methyl-7-nitro-1H-indole-3-carbonitrile (CAS: 289483-82-5) is primarily used in the pharmaceutical industry for the synthesis of complex organic molecules. It also finds applications in the polymer industry, where it can be used as a monomer for developing functional polymers. Additionally, it is used in the production of sensors and semiconductors due to its unique electronic properties.

About

English Name 4-methyl-7-nitro-1H-indole-3-carbonitrile
Molecular Formula C10H7N3O2
Molecular Weight 17.031 g/mol
SMILES CC1=C2C(=CNC2=C(C=C1)[N+](=O)[O-])C#N
InChIKey XDNBPEYPQDBCIK-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-methyl-7-nitro-1H-indole-3-carbonitrile (CAS: 289483-82-5)?

4-Methyl-7-nitro-1H-indole-3-carbonitrile (CAS: 289483-82-5) is a crystalline solid with a molecular...

Compound Q&A

How is 4-methyl-7-nitro-1H-indole-3-carbonitrile (CAS: 289483-82-5) typically synthesized?

4-Methyl-7-nitro-1H-indole-3-carbonitrile (CAS: 289483-82-5) is typically synthesized via a multiste...

Compound Q&A

What precautions should be taken when handling 4-methyl-7-nitro-1H-indole-3-carbonitrile (CAS: 289483-82-5)?

When handling 4-methyl-7-nitro-1H-indole-3-carbonitrile (CAS: 289483-82-5), it is essential to use p...

Compound Q&A

What is 3-Fluoro-2-methylbenzylamine (CAS: 771573-36-5)?

3-Fluoro-2-methylbenzylamine is an organic compound with the CAS number 771573-3...

771573-36-53-Fluoro-2-methylben...
Compound Q&A

Is Tert-butyl 2-(oxetan-3-ylidene)acetate (CAS: 1207175-03-8) safe?

Tert-butyl 2-(oxetan-3-ylidene)acetate is considered safe for its intended uses ...

1207175-03-8Tert-butyl 2-(oxetan...
Compound Q&A

What precautions should be taken when handling 4-Acetyl-2-fluorobenzonitrile (CAS: 214760-18-6)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab co...

214760-18-64-Acetyl-2-fluoroben...
Compound Q&A

How is 2-Ethyl-4-methyl-1,3-thiazole (CAS: 15679-12-6) typically synthesized?

2-Ethyl-4-methyl-1,3-thiazole is commonly synthesized via the reaction of thiour...

15679-12-62-Ethyl-4-methyl-1,3...