Compound Q&A

What precautions should be taken when handling 1-(4-iodophenyl)-2,5-dimethyl-1H-pyrrole (CAS: 288608-09-3)?

Answer

1-(4-iodophenyl)-2,5-dimethyl-1H-pyrrole
When handling 1-(4-iodophenyl)-2,5-dimethyl-1H-pyrrole, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be stored in a cool, well-ventilated area away from heat sources and oxidizing agents. Spills should be cleaned up carefully using appropriate absorbent materials, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for detailed information and emergency procedures.

About

English Name 1-(4-iodophenyl)-2,5-dimethyl-1H-pyrrole
Molecular Formula C12H12IN
Molecular Weight 297.14 g/mol
SMILES CC1=CC=C(N1C2=CC=C(C=C2)I)C
InChIKey CLGKGHWNVMDYQB-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-iodophenyl)-2,5-dimethyl-1H-pyrrole (CAS: 288608-09-3)?

1-(4-Iodophenyl)-2,5-dimethyl-1H-pyrrole is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 1-(4-iodophenyl)-2,5-dimethyl-1H-pyrrole (CAS: 288608-09-3) typically synthesized?

1-(4-Iodophenyl)-2,5-dimethyl-1H-pyrrole can be synthesized by first preparing 4-iodophenyl isocyani...

Compound Q&A

What industries use 1-(4-iodophenyl)-2,5-dimethyl-1H-pyrrole (CAS: 288608-09-3)?

1-(4-Iodophenyl)-2,5-dimethyl-1H-pyrrole is primarily used in the pharmaceutical and chemical indust...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...