Compound Q&A

What industries use 2-Hydroxy-L-tryptophan (CAS: 21704-80-3)?

Answer

2-Hydroxy-L-tryptophan
2-Hydroxy-L-tryptophan is primarily used in the pharmaceutical industry for the production of certain drugs that require L-tryptophan derivatives. It is also used in the food industry as a flavor enhancer and in research laboratories for studying the biochemistry of tryptophan and its derivatives. Additionally, it has potential applications in the polymer and semiconductor industries.

About

CAS No 21704-80-3
English Name 2-Hydroxy-L-tryptophan
Molecular Formula C11H12N2O3
Molecular Weight 220.23 g/mol
SMILES C1=CC=C2C(=C1)C(=C(N2)O)CC(C(=O)O)N
InChIKey VAUYGGXCASQWHK-QMMMGPOBSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-L-tryptophan (CAS: 21704-80-3)?

2-Hydroxy-L-tryptophan is a white to off-white powder, with a crystalline form. Its molecular weight...

Compound Q&A

How is 2-Hydroxy-L-tryptophan (CAS: 21704-80-3) typically synthesized?

2-Hydroxy-L-tryptophan can be synthesized by the reduction of L-tryptophylglycine, using hydrogen an...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-L-tryptophan (CAS: 21704-80-3)?

When handling 2-Hydroxy-L-tryptophan, it is recommended to use personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...