Compound Q&A

What industries use 2'-Cytidylic acid (CAS: 85-94-9)?

Answer

2'-Cytidylic acid
2'-Cytidylic acid is primarily used in the pharmaceutical industry for the synthesis of nucleoside analogs and antiviral drugs. It also finds applications in the polymer industry for the development of biodegradable polymers and in the semiconductor industry as a dopant in organic thin-film transistors.

About

CAS No 85-94-9
English Name 2'-Cytidylic acid
Molecular Formula C9H14N3O8P
Molecular Weight 323.2 g/mol
EINECS 201-643-1
SMILES c1cn(c(=O)nc1N)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)OP(=O)(O)O
InChIKey YQUAKORMLHPSLZ-XVFCMESISA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2'-Cytidylic acid (CAS: 85-94-9)?

2'-Cytidylic acid is a white crystalline solid with a molecular weight of approximately 346.21 g/mol...

Compound Q&A

How is 2'-Cytidylic acid (CAS: 85-94-9) typically synthesized?

2'-Cytidylic acid is commonly synthesized through the condensation of cytosine and ATP in the presen...

Compound Q&A

What precautions should be taken when handling 2'-Cytidylic acid (CAS: 85-94-9)?

When handling 2'-Cytidylic acid, it is important to wear appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...