Compound Q&A

What are the physical and chemical properties of {(3R)-1-[(1R)-1-Phenylethyl]-3-pyrrolidinyl}methanol (CAS: 99735-47-4)?

Answer

{(3R)-1-[(1R)-1-Phenylethyl]-3-pyrrolidinyl}methanol
The compound {(3R)-1-[(1R)-1-Phenylethyl]-3-pyrrolidinyl}methanol (CAS: 99735-47-4) has a crystalline form and a molecular weight of approximately 227.28 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, showing some basic properties due to the pyrrolidinyl group. It is also prone to esterification and amide formation under appropriate conditions.

About

CAS No 99735-47-4
English Name {(3R)-1-[(1R)-1-Phenylethyl]-3-pyrrolidinyl}methanol
Molecular Formula C13H19NO
Molecular Weight 205.30099999999993 g/mol
SMILES CC(C1=CC=CC=C1)N2CCC(C2)CO
InChIKey RQTYGPRJDFTUGU-VXGBXAGGSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is {(3R)-1-[(1R)-1-Phenylethyl]-3-pyrrolidinyl}methanol (CAS: 99735-47-4) typically synthesized?

The compound {(3R)-1-[(1R)-1-Phenylethyl]-3-pyrrolidinyl}methanol (CAS: 99735-47-4) is typically syn...

Compound Q&A

What industries use {(3R)-1-[(1R)-1-Phenylethyl]-3-pyrrolidinyl}methanol (CAS: 99735-47-4)?

The compound {(3R)-1-[(1R)-1-Phenylethyl]-3-pyrrolidinyl}methanol (CAS: 99735-47-4) finds applicatio...

Compound Q&A

What precautions should be taken when handling {(3R)-1-[(1R)-1-Phenylethyl]-3-pyrrolidinyl}methanol (CAS: 99735-47-4)?

When handling {(3R)-1-[(1R)-1-Phenylethyl]-3-pyrrolidinyl}methanol (CAS: 99735-47-4), it is importan...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...