Compound Q&A

What is 4-[(E)-(4-Chloro-3-sulfophenyl)diazenyl]-3-hydroxy-2-naphthoic acid - barium (1:1) (CAS: 76613-71-3)?

Answer

4-[(E)-(4-Chloro-3-sulfophenyl)diazenyl]-3-hydroxy-2-naphthoic acid - barium (1:1)
4-[(E)-(4-Chloro-3-sulfophenyl)diazenyl]-3-hydroxy-2-naphthoic acid - barium (1:1) is a complex chemical compound with the CAS number 76613-71-3. It is a barium salt of a specific naphthoic acid derivative, known for its unique functional groups and molecular structure.

About

CAS No 76613-71-3
English Name 4-[(E)-(4-Chloro-3-sulfophenyl)diazenyl]-3-hydroxy-2-naphthoic acid - barium (1:1)
Molecular Formula C17H11BaClN2O6S
Molecular Weight 546.15 g/mol
SMILES C1=CC=C2C(=C1)C=C(C(=C2N=NC3=CC(=C(C=C3)Cl)S(=O)(=O)[O-])[O-])C(=O)O.[Ba+2]
InChIKey BGBUKYAJFNJBHX-UHFFFAOYSA-N
Last Updated: 2026-01-04 05:07

Related Q&A

Compound Q&A

What are the main uses of 4-[(E)-(4-Chloro-3-sulfophenyl)diazenyl]-3-hydroxy-2-naphthoic acid - barium (1:1) (CAS: 76613-71-3)?

This compound is primarily used in research applications, particularly in analytical chemistry and s...

Compound Q&A

Is 4-[(E)-(4-Chloro-3-sulfophenyl)diazenyl]-3-hydroxy-2-naphthoic acid - barium (1:1) (CAS: 76613-71-3) safe?

While the compound is generally stable under normal conditions, it is important to handle it with ca...

Compound Q&A

How should 4-[(E)-(4-Chloro-3-sulfophenyl)diazenyl]-3-hydroxy-2-naphthoic acid - barium (1:1) (CAS: 76613-71-3) be stored?

This compound should be stored at a cool, dry place away from direct sunlight and moisture. It shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...