Compound Q&A

What is Benzenesulfonic acid,4-methyl-, copper(2+) salt (2:1) (CAS: 7144-37-8)?

Answer

Benzenesulfonic acid,4-methyl-, copper(2+) salt (2:1)
Benzenesulfonic acid,4-methyl-, copper(2+) salt (2:1) (CAS: 7144-37-8) is a complex inorganic compound. It is a salt consisting of copper(II) ions and 4-methylbenzenesulfonate anions. This compound is often used as a reagent in analytical chemistry and as a catalyst in various organic reactions.

About

CAS No 7144-37-8
English Name Benzenesulfonic acid,4-methyl-, copper(2+) salt (2:1)
Molecular Formula C14H14CuO6S2
Molecular Weight 405.9 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)[O-].CC1=CC=C(C=C1)S(=O)(=O)[O-].[Cu+2]
InChIKey MRYMYQPDGZIGDM-UHFFFAOYSA-L
Last Updated: 2026-01-04 05:07

Related Q&A

Compound Q&A

What are the main uses of Benzenesulfonic acid,4-methyl-, copper(2+) salt (2:1) (CAS: 7144-37-8)?

Benzenesulfonic acid,4-methyl-, copper(2+) salt (2:1) (CAS: 7144-37-8) is primarily used as a cataly...

Compound Q&A

Is Benzenesulfonic acid,4-methyl-, copper(2+) salt (2:1) (CAS: 7144-37-8) safe?

Benzenesulfonic acid,4-methyl-, copper(2+) salt (2:1) (CAS: 7144-37-8) is generally considered safe ...

Compound Q&A

How should Benzenesulfonic acid,4-methyl-, copper(2+) salt (2:1) (CAS: 7144-37-8) be stored?

Benzenesulfonic acid,4-methyl-, copper(2+) salt (2:1) (CAS: 7144-37-8) should be stored in a cool, d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...