Compound Q&A

How should Amylin (20-29) (CAS: 118068-30-7) be stored?

Answer

Amylin (20-29) (human)
Amylin (20-29) (CAS: 118068-30-7) should be stored in a cool, dry place, protected from light and moisture. It should be kept away from direct heat sources and stored in a tightly sealed container to maintain its stability and purity. Refrigeration is recommended to extend its shelf life and ensure optimal quality. Always follow the manufacturer's instructions for storage conditions and handling procedures.

About

English Name Amylin (20-29) (human)
Molecular Formula C43H68N12O16
Molecular Weight 1009.07 g/mol
SMILES CCC(C)C(C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(CO)C(=O)O)NC(=O)C(C)NC(=O)CNC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC(=O)N)NC(=O)C(CC(=O)N)NC(=O)C(CO)N
InChIKey RMSCIVKVSZSEHU-UHFFFAOYSA-N
Last Updated: 2026-01-03 23:08

Related Q&A

Compound Q&A

What is Amylin (20-29) (CAS: 118068-30-7)?

Amylin (20-29) (CAS: 118068-30-7) is a synthetic peptide fragment derived from human amylin, a hormo...

Compound Q&A

What are the main uses of Amylin (20-29) (CAS: 118068-30-7)?

Amylin (20-29) (CAS: 118068-30-7) is primarily used in pharmaceutical research as a model compound f...

Compound Q&A

Is Amylin (20-29) (CAS: 118068-30-7) safe?

Amylin (20-29) (CAS: 118068-30-7) is generally considered safe for research purposes when proper han...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...