Compound Q&A

What are the main uses of [4-(Triphenylsilyl)phenyl]boronic acid (CAS: 852475-03-7)?

Answer

[4-(Triphenylsilyl)phenyl]boronic acid
[4-(Triphenylsilyl)phenyl]boronic acid is primarily used in organic synthesis for protecting groups and as a precursor in the synthesis of other boronic acid derivatives. It is also used in the pharmaceutical industry for the development of new drugs and in chemical research for various reactions.

About

English Name [4-(Triphenylsilyl)phenyl]boronic acid
Molecular Formula C24H21BO2Si
Molecular Weight 380.33 g/mol
SMILES B(C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)(O)O
InChIKey PMOBXFBCSAQLOY-UHFFFAOYSA-N
Last Updated: 2026-01-03 23:08

Related Q&A

Compound Q&A

What is [4-(Triphenylsilyl)phenyl]boronic acid (CAS: 852475-03-7)?

[4-(Triphenylsilyl)phenyl]boronic acid is an organoboron compound with the CAS number 852475-03-7. I...

Compound Q&A

Is [4-(Triphenylsilyl)phenyl]boronic acid (CAS: 852475-03-7) safe?

[4-(Triphenylsilyl)phenyl]boronic acid is generally safe when handled with proper precautions. It is...

Compound Q&A

How should [4-(Triphenylsilyl)phenyl]boronic acid (CAS: 852475-03-7) be stored?

[4-(Triphenylsilyl)phenyl]boronic acid should be stored in well-sealed containers at room temperatur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...