Compound Q&A

What is ethyl 3-(phenylamino)benzoate (CAS: 1369265-53-1)?

Answer

ethyl 3-(phenylamino)benzoate
Ethyl 3-(phenylamino)benzoate is a synthetic organic compound with the CAS number 1369265-53-1. It is an ester derived from benzoic acid and contains a phenylamino group. This compound is used in various applications including pharmaceuticals, research, and industrial processes due to its unique chemical properties.

About

English Name ethyl 3-(phenylamino)benzoate
Molecular Formula C15H15NO2
Molecular Weight 241.29000000000002 g/mol
SMILES CCOC(=O)c1cccc(Nc2ccccc2)c1
InChIKey IFERRBZMLVXUEE-UHFFFAOYSA-N
Last Updated: 2026-01-03 23:08

Related Q&A

Compound Q&A

What are the main uses of ethyl 3-(phenylamino)benzoate (CAS: 1369265-53-1)?

Ethyl 3-(phenylamino)benzoate is primarily used in pharmaceuticals for its analgesic and anti-inflam...

Compound Q&A

Is ethyl 3-(phenylamino)benzoate (CAS: 1369265-53-1) safe?

Ethyl 3-(phenylamino)benzoate is generally considered safe when handled properly. However, it should...

Compound Q&A

How should ethyl 3-(phenylamino)benzoate (CAS: 1369265-53-1) be stored?

Ethyl 3-(phenylamino)benzoate should be stored in a cool, dry place away from direct sunlight and he...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...