Compound Q&A

What are the main uses of (2,3-Dimethylphenoxy)acetic acid (CAS: 2935-63-9)?

Answer

(2,3-Dimethylphenoxy)acetic acid
(2,3-Dimethylphenoxy)acetic acid is primarily used as a pesticide, specifically as a herbicide, in agriculture. It is also used as a precursor in the synthesis of other organic compounds and pharmaceuticals. Additionally, it can be utilized in research settings for various studies related to organic chemistry and biological activity.

About

CAS No 2935-63-9
English Name (2,3-Dimethylphenoxy)acetic acid
Molecular Formula C10H12O3
Molecular Weight 180.2 g/mol
SMILES CC1=C(C(=CC=C1)OCC(=O)O)C
InChIKey AVDBMBYECMTQJQ-UHFFFAOYSA-N
Last Updated: 2026-01-03 23:08

Related Q&A

Compound Q&A

What is (2,3-Dimethylphenoxy)acetic acid (CAS: 2935-63-9)?

(2,3-Dimethylphenoxy)acetic acid, also known as 2,3-Dimethylphenoxycarboxylic acid, is a phenolic co...

Compound Q&A

Is (2,3-Dimethylphenoxy)acetic acid (CAS: 2935-63-9) safe?

(2,3-Dimethylphenoxy)acetic acid can be hazardous if not handled properly. It is classified as a ski...

Compound Q&A

How should (2,3-Dimethylphenoxy)acetic acid (CAS: 2935-63-9) be stored?

(2,3-Dimethylphenoxy)acetic acid should be stored in a cool, dry place away from direct sunlight and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...