Compound Q&A

What is 1,1',1'',1'''-Benzene-1,2,4,5-tetrayltetrakis(1H-imidazole) (CAS: 1220714-37-3)?

Answer

1,1',1'',1'''-Benzene-1,2,4,5-tetrayltetrakis(1H-imidazole)
1,1',1'',1'''-Benzene-1,2,4,5-tetrayltetrakis(1H-imidazole) is a complex aromatic compound with the CAS number 1220714-37-3. It is an organic molecule featuring benzene ring with four 1H-imidazole groups attached. This compound has potential applications in pharmaceuticals and materials science due to its unique structural properties.

About

English Name 1,1',1'',1'''-Benzene-1,2,4,5-tetrayltetrakis(1H-imidazole)
Molecular Formula C18H14N8
Molecular Weight 342.37 g/mol
SMILES c1ncn(c1)c1cc(n2cncc2)c(cc1n1cncc1)n1cncc1
InChIKey DZKDAFGOBRZQPO-UHFFFAOYSA-N
Last Updated: 2026-01-03 19:02

Related Q&A

Compound Q&A

What are the main uses of 1,1',1'',1'''-Benzene-1,2,4,5-tetrayltetrakis(1H-imidazole) (CAS: 1220714-37-3)?

1,1',1'',1'''-Benzene-1,2,4,5-tetrayltetrakis(1H-imidazole) is primarily used in pharmaceutical rese...

Compound Q&A

Is 1,1',1'',1'''-Benzene-1,2,4,5-tetrayltetrakis(1H-imidazole) (CAS: 1220714-37-3) safe?

1,1',1'',1'''-Benzene-1,2,4,5-tetrayltetrakis(1H-imidazole) is generally considered safe under prope...

Compound Q&A

How should 1,1',1'',1'''-Benzene-1,2,4,5-tetrayltetrakis(1H-imidazole) (CAS: 1220714-37-3) be stored?

1,1',1'',1'''-Benzene-1,2,4,5-tetrayltetrakis(1H-imidazole) should be stored in a cool, dry place aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...