Compound Q&A

How should Bis(2-methyl-2-propanyl) (4-chloro-2-pyrimidinyl)imidodicarbonate (CAS: 1464788-84-8) be stored?

Answer

Bis(2-methyl-2-propanyl) (4-chloro-2-pyrimidinyl)imidodicarbonate
Bis(2-methyl-2-propanyl) (4-chloro-2-pyrimidinyl)imidodicarbonate should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a sealed container to prevent moisture absorption and degradation.

About

English Name Bis(2-methyl-2-propanyl) (4-chloro-2-pyrimidinyl)imidodicarbonate
Molecular Formula C14H20ClN3O4
Molecular Weight 329.78 g/mol
SMILES CC(C)(C)OC(=O)N(c1nccc(n1)Cl)C(=O)OC(C)(C)C
InChIKey LTWPYVSBBSMSNR-UHFFFAOYSA-N
Last Updated: 2026-01-03 19:02

Related Q&A

Compound Q&A

What is Bis(2-methyl-2-propanyl) (4-chloro-2-pyrimidinyl)imidodicarbonate (CAS: 1464788-84-8)?

Bis(2-methyl-2-propanyl) (4-chloro-2-pyrimidinyl)imidodicarbonate is a chemical compound with a comp...

Compound Q&A

What are the main uses of Bis(2-methyl-2-propanyl) (4-chloro-2-pyrimidinyl)imidodicarbonate (CAS: 1464788-84-8)?

Bis(2-methyl-2-propanyl) (4-chloro-2-pyrimidinyl)imidodicarbonate is primarily used in pharmaceutica...

Compound Q&A

Is Bis(2-methyl-2-propanyl) (4-chloro-2-pyrimidinyl)imidodicarbonate (CAS: 1464788-84-8) safe?

Bis(2-methyl-2-propanyl) (4-chloro-2-pyrimidinyl)imidodicarbonate is generally safe when handled wit...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...