Compound Q&A

Is (11beta,16alpha)-9,21-Dichloro-16-methyl-3,20-dioxopregna-1,4-diene-11,17-diyl di(2-furoate) (CAS: 1370190-33-2) safe?

Answer

(11beta,16alpha)-9,21-Dichloro-16-methyl-3,20-dioxopregna-1,4-diene-11,17-diyl di(2-furoate)
This compound is not considered safe for general use and should be handled with caution due to its complex chemical structure. Specific safety measures, including appropriate personal protective equipment and knowledge of handling procedures, are required. Always follow laboratory safety protocols.

About

English Name (11beta,16alpha)-9,21-Dichloro-16-methyl-3,20-dioxopregna-1,4-diene-11,17-diyl di(2-furoate)
Molecular Formula C32H32Cl2O8
Molecular Weight 615.51 g/mol
SMILES C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CCl)OC(=O)c5ccco5)C)OC(=O)c6ccco6)Cl)C
InChIKey MJDGUHJEIVTMQZ-VYYCQGSCSA-N
Last Updated: 2026-01-03 19:02

Related Q&A

Compound Q&A

What is (11beta,16alpha)-9,21-Dichloro-16-methyl-3,20-dioxopregna-1,4-diene-11,17-diyl di(2-furoate) (CAS: 1370190-33-2)?

This compound is a specific steroid derivative with a unique structural feature, including dichloro ...

Compound Q&A

What are the main uses of (11beta,16alpha)-9,21-Dichloro-16-methyl-3,20-dioxopregna-1,4-diene-11,17-diyl di(2-furoate) (CAS: 1370190-33-2)?

This compound is primarily used in research and development for its unique chemical structure, which...

Compound Q&A

How should (11beta,16alpha)-9,21-Dichloro-16-methyl-3,20-dioxopregna-1,4-diene-11,17-diyl di(2-furoate) (CAS: 1370190-33-2) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and sources of heat. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...