Compound Q&A

What is N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide) (CAS: 62715-83-7)?

Answer

N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide)
N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide) is a chemical compound with the CAS number 62715-83-7. It is an amide derivative with a molecular formula of C14H11Cl2N3O6. This compound is characterized by its stability and potential use in various applications due to its chemical properties.

About

CAS No 62715-83-7
English Name N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide)
Molecular Formula C14H14Cl2N2O4
Molecular Weight 345.18 g/mol
SMILES CC(=O)N(C1=CC(=C(C=C1Cl)N(C(=O)C)C(=O)C)Cl)C(=O)C
InChIKey SJPBZTWPPJKLBP-UHFFFAOYSA-N
Last Updated: 2026-01-03 15:45

Related Q&A

Compound Q&A

What are the main uses of N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide) (CAS: 62715-83-7)?

N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide) is primarily used in the pharmaceutical indu...

Compound Q&A

Is N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide) (CAS: 62715-83-7) safe?

N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide) (CAS: 62715-83-7) is generally considered sa...

Compound Q&A

How should N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide) (CAS: 62715-83-7) be stored?

N,N'-(2,5-Dichloro-1,4-phenylene)bis(N-acetylacetamide) should be stored in a cool, dry place away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...