Compound Q&A

What is 4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid (CAS: 78218-09-4)?

Answer

4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid
4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid is a chemical compound with the CAS number 78218-09-4. It is an aromatic carboxylic acid containing a benzoic acid structure and an imidazole-derived ethoxy group. This compound is water-soluble and has a molecular formula of C14H14N2O3. It is used in various applications due to its unique chemical properties.

About

CAS No 78218-09-4
English Name 4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid
Molecular Formula C12H12N2O3
Molecular Weight 232.24 g/mol
SMILES C1=CC(=CC=C1C(=O)O)OCCN2C=CN=C2
InChIKey XQGZSYKGWHUSDH-UHFFFAOYSA-N
Last Updated: 2026-01-03 15:45

Related Q&A

Compound Q&A

What are the main uses of 4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid (CAS: 78218-09-4)?

4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid (CAS: 78218-09-4) is primarily used in pharmaceutical app...

Compound Q&A

Is 4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid (CAS: 78218-09-4) safe?

4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid (CAS: 78218-09-4) can be considered safe under proper han...

Compound Q&A

How should 4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid (CAS: 78218-09-4) be stored?

4-[2-(1H-Imidazol-1-yl)ethoxy]benzoic acid (CAS: 78218-09-4) should be stored in a cool, dry place a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...