Compound Q&A

What is 2-Naphthalenesulfonic acid (~2~H_1_)ammoniate (1:1) (CAS: 51548-48-2)?

Answer

2-Naphthalenesulfonic acid (~2~H_1_)ammoniate (1:1)
2-Naphthalenesulfonic acid (~2~H_1_)ammoniate (1:1) is a chemical compound with the CAS number 51548-48-2. It is an ionic compound derived from 2-naphthalenesulfonic acid and ammonium. It is commonly used in analytical chemistry and as a reagent in various laboratory procedures. Its molecular formula is C10H7O3S·NH4+.

About

CAS No 51548-48-2
English Name 2-Naphthalenesulfonic acid (~2~H_1_)ammoniate (1:1)
Molecular Formula C10H10DNO3S
Molecular Weight 226.28 g/mol
SMILES C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C(=C1)N
InChIKey ICZCGYVEJDDKLM-DYCDLGHISA-N
Last Updated: 2026-01-03 15:45

Related Q&A

Compound Q&A

What are the main uses of 2-Naphthalenesulfonic acid (~2~H_1_)ammoniate (1:1) (CAS: 51548-48-2)?

2-Naphthalenesulfonic acid (~2~H_1_)ammoniate (1:1) is primarily used as a reagent in analytical che...

Compound Q&A

Is 2-Naphthalenesulfonic acid (~2~H_1_)ammoniate (1:1) (CAS: 51548-48-2) safe?

2-Naphthalenesulfonic acid (~2~H_1_)ammoniate (1:1) is generally considered safe when handled with a...

Compound Q&A

How should 2-Naphthalenesulfonic acid (~2~H_1_)ammoniate (1:1) (CAS: 51548-48-2) be stored?

2-Naphthalenesulfonic acid (~2~H_1_)ammoniate (1:1) should be stored in a cool, dry place away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...