Compound Q&A

How should 1,4-Dimethyl-1H-indazole-5-boronic acid (CAS: 1310405-36-7) be stored?

Answer

1,4-Dimethyl-1H-indazole-5-boronic acid
1,4-Dimethyl-1H-indazole-5-boronic acid should be stored in a cool, dry place away from direct sunlight and heat sources. Keep the compound in a tightly sealed container to prevent moisture absorption. It is recommended to store it at room temperature (15-25°C) and avoid exposure to high humidity and light to maintain its stability.

About

English Name 1,4-Dimethyl-1H-indazole-5-boronic acid
Molecular Formula C9H11BN2O2
Molecular Weight 190.01 g/mol
SMILES B(C1=C(C2=C(C=C1)N(N=C2)C)C)(O)O
InChIKey ATHVOUQWKYPARY-UHFFFAOYSA-N
Last Updated: 2026-01-03 12:17

Related Q&A

Compound Q&A

What is 1,4-Dimethyl-1H-indazole-5-boronic acid (CAS: 1310405-36-7)?

1,4-Dimethyl-1H-indazole-5-boronic acid is an organic compound with the CAS number 1310405-36-7. It ...

Compound Q&A

What are the main uses of 1,4-Dimethyl-1H-indazole-5-boronic acid (CAS: 1310405-36-7)?

1,4-Dimethyl-1H-indazole-5-boronic acid is primarily used in pharmaceutical and chemical synthesis a...

Compound Q&A

Is 1,4-Dimethyl-1H-indazole-5-boronic acid (CAS: 1310405-36-7) safe?

1,4-Dimethyl-1H-indazole-5-boronic acid is generally considered safe under normal handling condition...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...