Compound Q&A

What is 5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid (CAS: 1883595-38-7)?

Answer

5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid
5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid is an organic compound with the CAS number 1883595-38-7. It is a derivative of pyrrole and contains a fluorophenyl group attached to the nitrogen atom of the pyrrole ring. This compound is known for its structural complexity and potential use in medicinal chemistry and material science.

About

English Name 5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid
Molecular Formula C11H8FNO2
Molecular Weight 205.19 g/mol
SMILES c1ccc(c(c1)c2cc(c[nH]2)C(=O)O)F
InChIKey SWSZTLBZFMBSQC-UHFFFAOYSA-N
Last Updated: 2026-01-03 12:17

Related Q&A

Compound Q&A

What are the main uses of 5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid (CAS: 1883595-38-7)?

5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid is primarily used in the pharmaceutical industry as ...

Compound Q&A

Is 5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid (CAS: 1883595-38-7) safe?

5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid is generally safe when handled with appropriate prec...

Compound Q&A

How should 5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid (CAS: 1883595-38-7) be stored?

5-(2-Fluorophenyl)-1H-pyrrole-3-carboxylic acid should be stored in a cool, dry place, away from dir...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...