Compound Q&A

What are the main uses of Ethyl 4-(4-hydroxyphenyl)-1-piperazinecarboxylate (CAS: 67914-99-2)?

Answer

Ethyl 4-(4-hydroxyphenyl)-1-piperazinecarboxylate
Ethyl 4-(4-hydroxyphenyl)-1-piperazinecarboxylate (CAS: 67914-99-2) is mainly used in the pharmaceutical industry for developing drugs that target specific receptor sites. It is also utilized in research settings for its pharmacological properties, such as its ability to interact with G-protein coupled receptors. In the food industry, it is not typically used due to its limited stability and potential to degrade.

About

CAS No 67914-99-2
English Name Ethyl 4-(4-hydroxyphenyl)-1-piperazinecarboxylate
Molecular Formula C13H18N2O3
Molecular Weight 250.3 g/mol
SMILES CCOC(=O)N1CCN(CC1)c2ccc(cc2)O
InChIKey KHOWEYYVJZGGIU-UHFFFAOYSA-N
Last Updated: 2026-01-03 05:32

Related Q&A

Compound Q&A

What is Ethyl 4-(4-hydroxyphenyl)-1-piperazinecarboxylate (CAS: 67914-99-2)?

Ethyl 4-(4-hydroxyphenyl)-1-piperazinecarboxylate (CAS: 67914-99-2) is a chemical compound used prim...

Compound Q&A

Is Ethyl 4-(4-hydroxyphenyl)-1-piperazinecarboxylate (CAS: 67914-99-2) safe?

Ethyl 4-(4-hydroxyphenyl)-1-piperazinecarboxylate (CAS: 67914-99-2) is generally considered safe for...

Compound Q&A

How should Ethyl 4-(4-hydroxyphenyl)-1-piperazinecarboxylate (CAS: 67914-99-2) be stored?

Ethyl 4-(4-hydroxyphenyl)-1-piperazinecarboxylate (CAS: 67914-99-2) should be stored in a cool, dry ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...