Compound Q&A

What is 1-(Isopropylsulfanyl)-2-nitrobenzene (CAS: 70415-85-9)?

Answer

1-(Isopropylsulfanyl)-2-nitrobenzene
1-(Isopropylsulfanyl)-2-nitrobenzene (CAS: 70415-85-9) is an organic compound with the molecular formula C9H11NO2S. It is a nitrobenzene derivative with an isopropylsulfanyl group attached to the second carbon atom. This compound is used in various industrial and pharmaceutical applications due to its unique chemical properties.

About

CAS No 70415-85-9
English Name 1-(Isopropylsulfanyl)-2-nitrobenzene
Molecular Formula C9H11NO2S
Molecular Weight 197.25 g/mol
SMILES CC(Sc1ccccc1[N+](=O)[O-])C
InChIKey WRFYXBKJHZAUTO-UHFFFAOYSA-N
Last Updated: 2026-01-03 05:32

Related Q&A

Compound Q&A

What are the main uses of 1-(Isopropylsulfanyl)-2-nitrobenzene (CAS: 70415-85-9)?

1-(Isopropylsulfanyl)-2-nitrobenzene (CAS: 70415-85-9) is primarily used in the pharmaceutical indus...

Compound Q&A

Is 1-(Isopropylsulfanyl)-2-nitrobenzene (CAS: 70415-85-9) safe?

1-(Isopropylsulfanyl)-2-nitrobenzene (CAS: 70415-85-9) is generally considered safe when handled wit...

Compound Q&A

How should 1-(Isopropylsulfanyl)-2-nitrobenzene (CAS: 70415-85-9) be stored?

1-(Isopropylsulfanyl)-2-nitrobenzene (CAS: 70415-85-9) should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...