Compound Q&A

Are there alternatives to (+)-Puerol B 2''-O-Glucoside (CAS: 868409-19-2) in synthesis?

Answer

(+)-Puerol B 2''-O-Glucoside
In the synthesis of (+)-Puerol B 2''-O-Glucoside (CAS: 868409-19-2), alternative reagents such as other glucosides or different isomers of similar compounds can be used. Analogous compounds like (−)-Puerol B or other puerarin derivatives are also viable substitutes depending on the specific application.

About

English Name (+)-Puerol B 2''-O-Glucoside
Molecular Formula C24H26O10
Molecular Weight 474.46 g/mol
SMILES COC1=CC(=C(C=C1)C2=CC(=O)O[C@@H]2CC3=CC=C(C=C3)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O
InChIKey IOVBNDMOPKKFCH-ZAUXWKBESA-N
Last Updated: 2026-01-02 18:24

Related Q&A

Compound Q&A

What regulatory guidelines apply to (+)-Puerol B 2''-O-Glucoside (CAS: 868409-19-2)?

Regulatory guidelines for (+)-Puerol B 2''-O-Glucoside (CAS: 868409-19-2) include GHS classification...

Compound Q&A

What is the market or research trend for (+)-Puerol B 2''-O-Glucoside (CAS: 868409-19-2)?

The market for (+)-Puerol B 2''-O-Glucoside (CAS: 868409-19-2) is growing due to its potential healt...

Compound Q&A

How should waste containing (+)-Puerol B 2''-O-Glucoside (CAS: 868409-19-2) be handled?

Waste containing (+)-Puerol B 2''-O-Glucoside (CAS: 868409-19-2) should be collected in appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...