Compound Q&A

What industries use 2-Methyl-2-propanyl [(2S)-3-methyl-1-oxo-2-butanyl]carbamate (CAS: 79069-51-5)?

Answer

2-Methyl-2-propanyl [(2S)-3-methyl-1-oxo-2-butanyl]carbamate
2-Methyl-2-propanyl [(2S)-3-methyl-1-oxo-2-butanyl]carbamate is primarily used in the pharmaceutical industry for the synthesis of various drugs due to its reactivity and chemical properties. It is also applicable in the polymer industry for the preparation of advanced materials and in the sensor industry as a functional component. Its unique structure also makes it useful in semiconductor applications for specific chemical processes.

About

CAS No 79069-51-5
English Name 2-Methyl-2-propanyl [(2S)-3-methyl-1-oxo-2-butanyl]carbamate
Molecular Formula C10H19NO3
Molecular Weight 201.27 g/mol
SMILES O=C(OC(C)(C)C)N[C@@H](C(C)C)C=O
InChIKey YMNBXYLOSIKZGL-MRVPVSSYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(2S)-3-methyl-1-oxo-2-butanyl]carbamate (CAS: 79069-51-5)?

2-Methyl-2-propanyl [(2S)-3-methyl-1-oxo-2-butanyl]carbamate is a colorless to white crystalline sol...

Compound Q&A

How is 2-Methyl-2-propanyl [(2S)-3-methyl-1-oxo-2-butanyl]carbamate (CAS: 79069-51-5) typically synthesized?

2-Methyl-2-propanyl [(2S)-3-methyl-1-oxo-2-butanyl]carbamate is synthesized via a multi-step process...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [(2S)-3-methyl-1-oxo-2-butanyl]carbamate (CAS: 79069-51-5)?

When handling 2-Methyl-2-propanyl [(2S)-3-methyl-1-oxo-2-butanyl]carbamate, it is crucial to use per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...